2,3,4-Trifluoro-5-nitrobenzoic acid structure
|
Common Name | 2,3,4-Trifluoro-5-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 197520-71-1 | Molecular Weight | 221.090 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 349.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C7H2F3NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.3±27.9 °C | |
| Name | 2,3,4-trifluoro-5-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 349.7±42.0 °C at 760 mmHg |
| Molecular Formula | C7H2F3NO4 |
| Molecular Weight | 221.090 |
| Flash Point | 165.3±27.9 °C |
| Exact Mass | 220.993591 |
| PSA | 83.12000 |
| LogP | 1.48 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.541 |
| InChIKey | BCMIOBTWFPSPJJ-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc([N+](=O)[O-])c(F)c(F)c1F |
| HS Code | 2916399090 |
|---|
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 5-nitro-2,3,4-trifluorobenzoic acid |
| 2,3,4-Trifluoro-5-nitrobenzoic acid |
| 2,3,4,5,6-PENTAFLUOROBENZYL PROPIONATE |
| Benzoic acid, 2,3,4-trifluoro-5-nitro- |
| PC8688 |
| 2,3,4-Trifluoro-5-nitro-benzoic acid |