ethyl 2-ethoxy-3-(4-hydroxyphenyl)propanoate structure
|
Common Name | ethyl 2-ethoxy-3-(4-hydroxyphenyl)propanoate | ||
|---|---|---|---|---|
| CAS Number | 197299-16-4 | Molecular Weight | 238.28000 | |
| Density | 1.116g/cm3 | Boiling Point | 367.296ºC at 760 mmHg | |
| Molecular Formula | C13H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 134.932ºC | |
| Name | ethyl 2-ethoxy-3-(4-hydroxyphenyl)propanoate |
|---|
| Density | 1.116g/cm3 |
|---|---|
| Boiling Point | 367.296ºC at 760 mmHg |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28000 |
| Flash Point | 134.932ºC |
| Exact Mass | 238.12100 |
| PSA | 55.76000 |
| LogP | 1.90290 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.515 |
| InChIKey | NEJJCKFYYBEQRQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(Cc1ccc(O)cc1)OCC |
| HS Code | 2918990090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 2 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |