Ethyl 3-(2,3-Dihydrobenzofuran-5-yl)propenoate structure
|
Common Name | Ethyl 3-(2,3-Dihydrobenzofuran-5-yl)propenoate | ||
|---|---|---|---|---|
| CAS Number | 196597-65-6 | Molecular Weight | 218.24800 | |
| Density | 1.166g/cm3 | Boiling Point | 355.7ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 148.2ºC | |
| Name | ethyl 3-(2,3-dihydro-1-benzofuran-5-yl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.166g/cm3 |
|---|---|
| Boiling Point | 355.7ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 148.2ºC |
| Exact Mass | 218.09400 |
| PSA | 35.53000 |
| LogP | 2.19780 |
| Vapour Pressure | 3.07E-05mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | SJGFAGDJJKISNM-GQCTYLIASA-N |
| SMILES | CCOC(=O)C=Cc1ccc2c(c1)CCO2 |
| Storage condition | -20°C |
|
~91%
Ethyl 3-(2,3-Di... CAS#:196597-65-6 |
| Literature: Takeda Chemical Industries, Ltd. Patent: US6348485 B1, 2002 ; |
|
~%
Ethyl 3-(2,3-Di... CAS#:196597-65-6 |
| Literature: Journal of Medicinal Chemistry, , vol. 45, # 19 p. 4222 - 4239 |
|
~95%
Ethyl 3-(2,3-Di... CAS#:196597-65-6 |
| Literature: Coleman, Paul J.; Hutchinson, John H.; Hunt, Cecilia A.; Lu, Ping; Delaporte, Enock; Rushmore, Tom Tetrahedron Letters, 2000 , vol. 41, # 31 p. 5803 - 5806 |
| Precursor 4 | |
|---|---|
| DownStream 8 | |
| ethyl (E)-3-(2,3-dihydro-1-benzofuran-5-yl)-2-propenoate |
| ethyl (E)-3-(2,3-Dihydrobenzofuran-5-yl)propenoate |
| (E)-ethyl 3-(2,3-dihydrobenzofuran-5-yl)acrylate |
| Ethyl(E)-3-(2,3-dihydrobenzofuran-5-yl)-2-propenoate |
| (E)-3-(2,3-Dihydrobenzo[b]furan-5-yl)-2-propenoic acid ethyl ester |
| ETHYL 3-(2,3-DIHYDROBENZOFURAN-5-YL)PROPENOATE |
| 2-Propenoic acid,3-(2,3-dihydro-5-benzofuranyl)-,ethyl ester,(2E) |
| ethyl 3-(2,3-dihydro-1-benzofuran-5-yl)acrylate |
| 2-Propenoicacid,3-(2,3-dihydro-5-benzofuranyl)-,ethyl ester,(E) |