2,2,4,4,6,6-hexachloro-1,3,5-trithiane 1,1,3,3-tetraoxide
Modify Date: 2025-09-24 15:25:45
2,2,4,4,6,6-hexachloro-1,3,5-trithiane 1,1,3,3-tetraoxide structure
|
Common Name | 2,2,4,4,6,6-hexachloro-1,3,5-trithiane 1,1,3,3-tetraoxide | ||
|---|---|---|---|---|
| CAS Number | 1965-15-7 | Molecular Weight | 408.94300 | |
| Density | 2.21g/cm3 | Boiling Point | 597.9ºC at 760 mmHg | |
| Molecular Formula | C3Cl6O4S3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.4ºC | |
| Name | 2,2,4,4,6,6-hexachloro-1,3,5-trithiane 1,1,3,3-tetraoxide |
|---|---|
| Synonym | More Synonyms |
| Density | 2.21g/cm3 |
|---|---|
| Boiling Point | 597.9ºC at 760 mmHg |
| Molecular Formula | C3Cl6O4S3 |
| Molecular Weight | 408.94300 |
| Flash Point | 315.4ºC |
| Exact Mass | 405.70900 |
| PSA | 110.34000 |
| LogP | 4.99110 |
| Vapour Pressure | 1.26E-13mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | LTFVAHUBQZZACV-UHFFFAOYSA-N |
| SMILES | O=S1(=O)C(Cl)(Cl)SC(Cl)(Cl)S(=O)(=O)C1(Cl)Cl |
|
~%
2,2,4,4,6,6-hex... CAS#:1965-15-7 |
| Literature: Farrar Journal of the Chemical Society, 1956 , p. 508,510 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Hexachlor-[1,3,5]trithian-1,1,3,3-tetraoxid |
| Hexachlor-s-trithian-1,3-bis-dioxid |
| hexachloro-[1,3,5]trithiane-1,1,3,3-tetraoxide |