(dimethyl ester of mesoporphyrin IX)cobalt(II) structure
|
Common Name | (dimethyl ester of mesoporphyrin IX)cobalt(II) | ||
|---|---|---|---|---|
| CAS Number | 19630-46-7 | Molecular Weight | 651.66000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C36H40CoN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (dimethyl ester of mesoporphyrin IX)cobalt(II) |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C36H40CoN4O4 |
|---|---|
| Molecular Weight | 651.66000 |
| Exact Mass | 651.23800 |
| PSA | 72.32000 |
| LogP | 2.34040 |
| InChIKey | LEWFENGWTQMYJR-UHFFFAOYSA-N |
| SMILES | CCC1=C(C)c2cc3[n-]c(cc4nc(cc5[n-]c(cc1n2)c(C)c5CCC(=O)OC)C(CCC(=O)OC)=C4C)c(C)c3CC.[Co+2] |
| Co-mesoporphyrin |