Evofolin B
Modify Date: 2025-08-25 23:33:03
Evofolin B structure
|
Common Name | Evofolin B | ||
|---|---|---|---|---|
| CAS Number | 1961305-60-1 | Molecular Weight | 318.321 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 559.2±50.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 206.1±23.6 °C | |
Use of Evofolin BEvofolin B is a natural phenol compound[1]. |
| Name | Evofolin B |
|---|---|
| Synonym | More Synonyms |
| Description | Evofolin B is a natural phenol compound[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 559.2±50.0 °C at 760 mmHg |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.321 |
| Flash Point | 206.1±23.6 °C |
| Exact Mass | 318.110352 |
| LogP | 1.14 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.614 |
| InChIKey | QMYGRGKKZBRZKH-LBPRGKRZSA-N |
| SMILES | COc1cc(C(=O)C(CO)c2ccc(O)c(OC)c2)ccc1O |
| MFCD20274767 |
| 1-Propanone, 3-hydroxy-1-(3-hydroxy-2-methoxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)- |
| 3-Hydroxy-1-(3-hydroxy-2-methoxyphenyl)-2-(4-hydroxy-3-methoxyphenyl)-1-propanone |