9H-Fluoren-9-ol,2-amino-3-bromo-7-fluoro- structure
|
Common Name | 9H-Fluoren-9-ol,2-amino-3-bromo-7-fluoro- | ||
|---|---|---|---|---|
| CAS Number | 1960-60-7 | Molecular Weight | 294.11900 | |
| Density | 1.75g/cm3 | Boiling Point | 456.8ºC at 760mmHg | |
| Molecular Formula | C13H9BrFNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 230.1ºC | |
| Name | 2-amino-3-bromo-7-fluoro-9H-fluoren-9-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.75g/cm3 |
|---|---|
| Boiling Point | 456.8ºC at 760mmHg |
| Molecular Formula | C13H9BrFNO |
| Molecular Weight | 294.11900 |
| Flash Point | 230.1ºC |
| Exact Mass | 292.98500 |
| PSA | 46.25000 |
| LogP | 3.81370 |
| Vapour Pressure | 3.88E-09mmHg at 25°C |
| Index of Refraction | 1.733 |
| InChIKey | CQNHTYFQSULBMH-UHFFFAOYSA-N |
| SMILES | Nc1cc2c(cc1Br)-c1ccc(F)cc1C2O |
| HS Code | 2922199090 |
|---|
|
~%
9H-Fluoren-9-ol... CAS#:1960-60-7 |
| Literature: Pan,H.-L.; Fletcher,T.L. J. Med. Chem., 1964 , vol. 7, p. 31 - 38 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HMS3085L05 |
| 2-Amino-3-brom-7-fluor-fluoren-9-ol |