Benzene,2-nitro-1-phenoxy-4-(trifluoromethyl)- structure
|
Common Name | Benzene,2-nitro-1-phenoxy-4-(trifluoromethyl)- | ||
|---|---|---|---|---|
| CAS Number | 1960-59-4 | Molecular Weight | 283.20300 | |
| Density | 1.378g/cm3 | Boiling Point | 309.8ºC at 760mmHg | |
| Molecular Formula | C13H8F3NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 141.2ºC | |
| Name | 2-nitro-1-phenoxy-4-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.378g/cm3 |
|---|---|
| Boiling Point | 309.8ºC at 760mmHg |
| Molecular Formula | C13H8F3NO3 |
| Molecular Weight | 283.20300 |
| Flash Point | 141.2ºC |
| Exact Mass | 283.04600 |
| PSA | 55.05000 |
| LogP | 4.92910 |
| Vapour Pressure | 0.00114mmHg at 25°C |
| Index of Refraction | 1.537 |
| InChIKey | FMPQPRZPVWQOMC-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(C(F)(F)F)ccc1Oc1ccccc1 |
| HS Code | 2909309090 |
|---|
|
~89%
Benzene,2-nitro... CAS#:1960-59-4 |
| Literature: Soula, Gerard Journal of Organic Chemistry, 1985 , vol. 50, # 20 p. 3717 - 3721 |
|
~72%
Benzene,2-nitro... CAS#:1960-59-4 |
| Literature: Renga, James M.; Wang, Pen-Chung Synthetic Communications, 1984 , vol. 14, # 1 p. 69 - 76 |
| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| hms543l08 |