7-bromo-1,4-benzodiazepin-2,5-dione structure
|
Common Name | 7-bromo-1,4-benzodiazepin-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 195986-74-4 | Molecular Weight | 255.06800 | |
| Density | 1.642g/cm3 | Boiling Point | 581ºC at 760mmHg | |
| Molecular Formula | C9H7BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.2ºC | |
| Name | 7-bromo-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.642g/cm3 |
|---|---|
| Boiling Point | 581ºC at 760mmHg |
| Molecular Formula | C9H7BrN2O2 |
| Molecular Weight | 255.06800 |
| Flash Point | 305.2ºC |
| Exact Mass | 253.96900 |
| PSA | 58.20000 |
| LogP | 1.59780 |
| Vapour Pressure | 1.72E-13mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | QTLHJODGGBYWLC-UHFFFAOYSA-N |
| SMILES | O=C1CNC(=O)c2cc(Br)ccc2N1 |
| HS Code | 2933990090 |
|---|
|
~75%
7-bromo-1,4-ben... CAS#:195986-74-4 |
| Literature: KUDOS PHARMACEUTICALS LIMITED Patent: WO2008/23161 A1, 2008 ; Location in patent: Page/Page column 118 ; WO 2008/023161 A1 |
|
~91%
7-bromo-1,4-ben... CAS#:195986-74-4 |
| Literature: Osman; El-Gendy; Omar; Wagdy Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2002 , vol. 41, # 4 p. 871 - 874 |
|
~%
7-bromo-1,4-ben... CAS#:195986-74-4 |
| Literature: Journal of Medicinal Chemistry, , vol. 42, # 25 p. 5241 - 5253 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| AC1MCH6Z |
| 7-bromo-1,4-benzodiazepine-2,5-dione |
| 2,3,4,5-Tetrahydro-7-bromo-1H-1,4-benzodiazepine-2,5-dione |
| 7-bromo-3,4-dihydro-1,4-benzodiazepin-2,5-dione |
| 7-bromo-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione |
| MFCD01318376 |
| 7-bromo-3,4-dihydro-1H-benzo[e][1,4]diazepin-2,5-dione |
| CTK4E1887 |