8-Chloro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione structure
|
Common Name | 8-Chloro-3,4-dihydro-1H-benzo[e][1,4]diazepine-2,5-dione | ||
|---|---|---|---|---|
| CAS Number | 195983-60-9 | Molecular Weight | 210.61700 | |
| Density | 1.394g/cm3 | Boiling Point | 566.3ºC at 760mmHg | |
| Molecular Formula | C9H7ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.3ºC | |
| Name | 8-chloro-3,4-dihydro-1H-1,4-benzodiazepine-2,5-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.394g/cm3 |
|---|---|
| Boiling Point | 566.3ºC at 760mmHg |
| Molecular Formula | C9H7ClN2O2 |
| Molecular Weight | 210.61700 |
| Flash Point | 296.3ºC |
| Exact Mass | 210.02000 |
| PSA | 58.20000 |
| LogP | 1.48870 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.58 |
| InChIKey | FAVPJIZQGHYIEW-UHFFFAOYSA-N |
| SMILES | O=C1CNC(=O)c2ccc(Cl)cc2N1 |
| Storage condition | 2-8°C |
| HS Code | 2933990090 |
|---|
|
~%
8-Chloro-3,4-di... CAS#:195983-60-9 |
| Literature: Journal of Medicinal Chemistry, , vol. 42, # 25 p. 5241 - 5253 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD02956114 |