N-(9,10-dioxoanthracen-1-yl)-4-nitrobenzamide
Modify Date: 2025-08-26 06:29:00
N-(9,10-dioxoanthracen-1-yl)-4-nitrobenzamide structure
|
Common Name | N-(9,10-dioxoanthracen-1-yl)-4-nitrobenzamide | ||
|---|---|---|---|---|
| CAS Number | 19591-14-1 | Molecular Weight | 372.33000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(9,10-dioxoanthracen-1-yl)-4-nitrobenzamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C21H12N2O5 |
|---|---|
| Molecular Weight | 372.33000 |
| Exact Mass | 372.07500 |
| PSA | 109.06000 |
| LogP | 4.21870 |
| InChIKey | WGHNATLBRRKWMQ-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc2c1C(=O)c1ccccc1C2=O)c1ccc([N+](=O)[O-])cc1 |
|
~%
N-(9,10-dioxoan... CAS#:19591-14-1 |
| Literature: Yoshida, Katsuhira; Okugawa, Tetsuo; Nagamtsu, Eiichi; Yamashita, Yoshio; Matsuoka, Masaru Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1984 , # 3 p. 529 - 533 |
|
~%
N-(9,10-dioxoan... CAS#:19591-14-1 |
| Literature: Hayashi; Fujino Kogyo Kagaku Zasshi, 1954 , vol. 57, p. 824 Chem.Abstr., 1956 , p. 278 |
| 1-(p-nitrobenzoylamino)anthraquinone |
| 1-(4-Nitro-benzamino)-anthrachinon |
| 4-nitro-benzoic acid-(9,10-dioxo-9,10-dihydro-[1]anthrylamide) |
| 4-Nitro-N-(9.10-dioxo-9.10-dihydro-anthryl-(1))-benzamid |
| F0015-0191 |
| 4-Nitro-benzoesaeure-(9,10-dioxo-9,10-dihydro-[1]anthrylamid) |