3,5-dihydroxy-2-(3-hydroxy-4-methoxy-phenyl)-6,7-dimethoxy-chromen-4-one structure
|
Common Name | 3,5-dihydroxy-2-(3-hydroxy-4-methoxy-phenyl)-6,7-dimethoxy-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 19587-65-6 | Molecular Weight | 360.31500 | |
| Density | 1.482g/cm3 | Boiling Point | 609.9ºC at 760 mmHg | |
| Molecular Formula | C18H16O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 223.7ºC | |
| Name | eupatin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.482g/cm3 |
|---|---|
| Boiling Point | 609.9ºC at 760 mmHg |
| Molecular Formula | C18H16O8 |
| Molecular Weight | 360.31500 |
| Flash Point | 223.7ºC |
| Exact Mass | 360.08500 |
| PSA | 118.59000 |
| LogP | 2.60260 |
| Vapour Pressure | 9.88E-16mmHg at 25°C |
| Index of Refraction | 1.658 |
| InChIKey | ZZEQOHMDRQUMMH-UHFFFAOYSA-N |
| SMILES | COc1ccc(-c2oc3cc(OC)c(OC)c(O)c3c(=O)c2O)cc1O |
| HS Code | 2914509090 |
|---|
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 3,5-dihydroxy-2-(3-hydroxy-4-methoxyphenyl)-6,7-dimethoxychromen-4-one |
| EUPATIN |
| 3,3',5-trihydroxy-4',6,7-trimethoxyflavone |
| Flavonoid K |