6-benzyl-2,4-dichlorophenol
Modify Date: 2024-01-05 15:01:08
6-benzyl-2,4-dichlorophenol structure
|
Common Name | 6-benzyl-2,4-dichlorophenol | ||
|---|---|---|---|---|
| CAS Number | 19578-81-5 | Molecular Weight | 253.12400 | |
| Density | 1.324g/cm3 | Boiling Point | 348.5ºC at 760mmHg | |
| Molecular Formula | C13H10Cl2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.1ºC | |
| Name | 2-benzyl-4,6-dichlorophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 348.5ºC at 760mmHg |
| Molecular Formula | C13H10Cl2O |
| Molecular Weight | 253.12400 |
| Flash Point | 136.1ºC |
| Exact Mass | 252.01100 |
| PSA | 20.23000 |
| LogP | 4.28980 |
| Vapour Pressure | 2.49E-05mmHg at 25°C |
| Index of Refraction | 1.621 |
| InChIKey | MJTIYXIISJNFMG-UHFFFAOYSA-N |
| SMILES | Oc1c(Cl)cc(Cl)cc1Cc1ccccc1 |
| HS Code | 2908199090 |
|---|
| HS Code | 2908199090 |
|---|---|
| Summary | HS: 2908199090. derivatives of polyphenols or phenol-alcohols containing only halogen substituents and their salts. VAT:17.0%. tax rebate rate:9.0%. supervision conditions:None. MFN tariff:5.5%. general tariff:30.0% |
| 2,4-Dichloro-6-benzylphenol |
| 2-Benzyl-4,6-dichlor-phenol |
| 6-Benzyl-2,4-dichlorophenol |
| 2-benzyl-4,6-dichloro-phenol |
| EINECS 243-167-7 |
| 3.5-Dichlor-2-hydroxy-1-benzyl-benzol |