1-[5-(chloromethyl)-3,4-dihydroxy-oxolan-2-yl]pyrimidine-2,4-dione structure
|
Common Name | 1-[5-(chloromethyl)-3,4-dihydroxy-oxolan-2-yl]pyrimidine-2,4-dione | ||
|---|---|---|---|---|
| CAS Number | 19556-54-8 | Molecular Weight | 262.64700 | |
| Density | 1.644g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H11ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5'-chloro-5'-deoxyuridine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.644g/cm3 |
|---|---|
| Molecular Formula | C9H11ClN2O5 |
| Molecular Weight | 262.64700 |
| Exact Mass | 262.03600 |
| PSA | 104.55000 |
| Index of Refraction | 1.619 |
| InChIKey | BQPRXEHWLMFKLL-UHFFFAOYSA-N |
| SMILES | O=c1ccn(C2OC(CCl)C(O)C2O)c(=O)[nH]1 |
|
~80%
1-[5-(chloromet... CAS#:19556-54-8 |
| Literature: Zhou, Yi-Sui; Miao; Zhao, Yu-Fen Synlett, 2000 , # 5 p. 671 - 673 |
|
~%
1-[5-(chloromet... CAS#:19556-54-8 |
| Literature: Robins; Hansske; Wnuk; Kanai Canadian Journal of Chemistry, 1991 , vol. 69, # 9 p. 1468 - 1474 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 5'-Desoxy-5'-chlor-uridin |
| 5'-Chlor-5'-desoxyuridin |
| 5'-Chlor-5'-deoxyuridin |
| 5'-chloro-5'-deoxy-uridine |