RCS-4 M10 metabolite
Modify Date: 2025-11-27 20:10:37
RCS-4 M10 metabolite structure
|
Common Name | RCS-4 M10 metabolite | ||
|---|---|---|---|---|
| CAS Number | 1952336-77-4 | Molecular Weight | 323.386 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 565.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C20H21NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 296.0±27.3 °C | |
Use of RCS-4 M10 metaboliteRCS-4 M10 metabolite is a major urinary metabolite of RCS-4, characterized by O-demethylation/monohydroxylation of the N-pentyl chain. |
| Name | RCS-4 M10 metabolite |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 565.9±40.0 °C at 760 mmHg |
| Molecular Formula | C20H21NO3 |
| Molecular Weight | 323.386 |
| Flash Point | 296.0±27.3 °C |
| Exact Mass | 323.152130 |
| LogP | 3.31 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | MNXXREQGUWIZBH-UHFFFAOYSA-N |
| SMILES | O=C(c1ccc(O)cc1)c1cn(CCCCCO)c2ccccc12 |
| [1-(5-Hydroxypentyl)-1H-indol-3-yl](4-hydroxyphenyl)methanone |
| Methanone, [1-(5-hydroxypentyl)-1H-indol-3-yl](4-hydroxyphenyl)- |
| RCS-4 M10 metabolite |