1,4-dihydro-3,5-diiodo-1-methyl-4-oxopyridine-2,6-dicarboxylic acid
Modify Date: 2025-10-25 10:45:58
1,4-dihydro-3,5-diiodo-1-methyl-4-oxopyridine-2,6-dicarboxylic acid structure
|
Common Name | 1,4-dihydro-3,5-diiodo-1-methyl-4-oxopyridine-2,6-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 1951-53-7 | Molecular Weight | 448.93800 | |
| Density | 2.77g/cm3 | Boiling Point | 411.4ºC at 760 mmHg | |
| Molecular Formula | C8H5I2NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.6ºC | |
| Name | 3,5-diiodo-1-methyl-4-oxopyridine-2,6-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 2.77g/cm3 |
|---|---|
| Boiling Point | 411.4ºC at 760 mmHg |
| Molecular Formula | C8H5I2NO5 |
| Molecular Weight | 448.93800 |
| Flash Point | 202.6ºC |
| Exact Mass | 448.82600 |
| PSA | 96.60000 |
| LogP | 0.99090 |
| Vapour Pressure | 6.42E-08mmHg at 25°C |
| Index of Refraction | 1.801 |
| InChIKey | QXXSPCOLSLNNNE-UHFFFAOYSA-N |
| SMILES | Cn1c(C(=O)O)c(I)c(=O)c(I)c1C(=O)O |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| N-Methyl-3,5-diiod-chelidon-saeure |
| 3,5-diiodo-1-methyl-4-oxo-1,4-dihydropyridine-2,6-dicarboxylic acid |
| 3,5-Dijod-1-methyl-4-oxo-1,4-dihydro-pyridin-2,6-dicarbonsaeure |