2-(Triphenylphosphoranylidene)malonic acid dimethyl ester
Modify Date: 2025-11-27 19:04:36
2-(Triphenylphosphoranylidene)malonic acid dimethyl ester structure
|
Common Name | 2-(Triphenylphosphoranylidene)malonic acid dimethyl ester | ||
|---|---|---|---|---|
| CAS Number | 19491-23-7 | Molecular Weight | 392.38400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C23H21O4P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | triphenylphosphonium bis(methoxycarbonyl)methylide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C23H21O4P |
|---|---|
| Molecular Weight | 392.38400 |
| Exact Mass | 392.11800 |
| PSA | 62.41000 |
| LogP | 2.49890 |
| InChIKey | BXNHZDBICLFYJE-UHFFFAOYSA-N |
| SMILES | COC(=O)C(C(=O)OC)=P(c1ccccc1)(c1ccccc1)c1ccccc1 |
| HS Code | 2931900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 2 | |
CAS#:619-50-1
CAS#:99-77-4| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Triphenylphosphonio-dicarbomethoxymethanid |
| Dimethoxycarbonylmethylen-triphenylphosphoran |
| dimethyl 2-(triphenylphosphoranylidene)malonate |
| di(methoxycarbonyl)methylene triphenylphosphorane |
| Triphenylphosphonio-dicarbomethoxymethanol |