L-796449
Modify Date: 2025-08-25 16:47:35
L-796449 structure
|
Common Name | L-796449 | ||
|---|---|---|---|---|
| CAS Number | 194608-80-5 | Molecular Weight | 495.03 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H27ClO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of L-796449L-796449 is a potent PPARγ agonist. L-796449 shows neuroprotective. L-796449 has the potential for the research of stroke[1]. |
| Name | L-796449 |
|---|
| Description | L-796449 is a potent PPARγ agonist. L-796449 shows neuroprotective. L-796449 has the potential for the research of stroke[1]. |
|---|---|
| Related Catalog | |
| Target |
PPARγ[1] |
| References |
| Molecular Formula | C28H27ClO4S |
|---|---|
| Molecular Weight | 495.03 |
| InChIKey | KAPDPGZDHUCILF-UHFFFAOYSA-N |
| SMILES | CCCc1c(OCCCSc2ccc(CC(=O)O)cc2Cl)ccc2c(-c3ccccc3)coc12 |