magnesium,2-methanidylthiophene,chloride
Modify Date: 2025-11-26 10:09:18
magnesium,2-methanidylthiophene,chloride structure
|
Common Name | magnesium,2-methanidylthiophene,chloride | ||
|---|---|---|---|---|
| CAS Number | 19432-64-5 | Molecular Weight | 156.91600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H5ClMgS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | magnesium,2-methanidylthiophene,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C5H5ClMgS |
|---|---|
| Molecular Weight | 156.91600 |
| Exact Mass | 155.96500 |
| PSA | 25.30000 |
| InChIKey | QTUWNGNQQNBAGJ-UHFFFAOYSA-M |
| SMILES | [CH2-]c1cccs1.[Cl-].[Mg+2] |
|
~%
magnesium,2-met... CAS#:19432-64-5 |
| Literature: Gaertner Journal of the American Chemical Society, 1951 , vol. 73, p. 3934,3937 |
| 2-thenyl magnesium chloride |
| 2-thienylmagnesium chloride |
| [2]thienyl-methyl magnesium (1+),chloride |
| [2]Thienyl-methylmagnesium(1+),Chlorid |
| Magnesium,chloro(2-thienylmethyl) |