1-(furan-2-yl)-3-(4-methoxyphenyl)prop-2-en-1-one structure
|
Common Name | 1-(furan-2-yl)-3-(4-methoxyphenyl)prop-2-en-1-one | ||
|---|---|---|---|---|
| CAS Number | 19430-55-8 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(furan-2-yl)-3-(4-methoxyphenyl)prop-2-en-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 39.44000 |
| LogP | 3.18430 |
| InChIKey | QZZMZWWBSNSOIY-RMKNXTFCSA-N |
| SMILES | COc1ccc(C=CC(=O)c2ccco2)cc1 |
|
~77%
1-(furan-2-yl)-... CAS#:19430-55-8 |
| Literature: Kabli; Khalaf; Zimaity; Khalil; Kaddah; Al-Rifaie Journal of the Indian Chemical Society, 1991 , vol. 68, # 1 p. 47 - 51 |
| 1-Furyl-3-(4-methoxyphenyl)propen-1-one |
| 2-Propen-1-one,1-(2-furanyl)-3-(4-methoxyphenyl) |
| 1-<4-Methoxy-phenyl>-3-<furyl-(2)>-propen-(1)-on-(2) |
| 1-<4-Methoxy-phenyl>-3-furyl-propen-(1)-on-(3) |
| 2-Propen-1-one,1-(2-furanyl)-3-(4-methoxyphenyl)-,(2Z) |
| 1-<Furyl-(2)>-3-<4-methoxy-phenyl>-propen-(2)-on-(1) |
| 3-Furyl-1-<4-methoxy-phenyl>-propen-(1)-on-(3) |
| 1-furan-2-yl-3-(4-methoxy-phenyl)-propenone |