N-[(4-methoxyphenyl)methylideneamino]-4-methyl-benzenesulfonamide structure
|
Common Name | N-[(4-methoxyphenyl)methylideneamino]-4-methyl-benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 19350-72-2 | Molecular Weight | 304.36400 | |
| Density | 1.2g/cm3 | Boiling Point | 463ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 233.8ºC | |
| Name | Chebulinic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 463ºC at 760 mmHg |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.36400 |
| Flash Point | 233.8ºC |
| Exact Mass | 304.08800 |
| PSA | 76.14000 |
| LogP | 3.78770 |
| Vapour Pressure | 9.41E-09mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | RTARYTGUYUAXBK-LFIBNONCSA-N |
| SMILES | COc1ccc(C=NNS(=O)(=O)c2ccc(C)cc2)cc1 |
| Storage condition | 2-8°C |
| HS Code | 2935009090 |
|---|
|
~92%
N-[(4-methoxyph... CAS#:19350-72-2 |
| Literature: Li, Pan; Wu, Chunrui; Zhao, Jingjing; Rogness, Donald C.; Shi, Feng Journal of Organic Chemistry, 2012 , vol. 77, # 7 p. 3149 - 3158 |
|
~%
N-[(4-methoxyph... CAS#:19350-72-2 |
| Literature: Kumar; Singh Indian Journal of Chemistry - Section B Organic and Medicinal Chemistry, 2001 , vol. 40, # 7 p. 579 - 583 |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| n-4'-methoxybenzylidene-n-butylaniline |
| 4-Methoxybenzylidene-4'-n-butylaniline |
| 4-methoxybenzaldehyde tosylhydrazone |
| 4-methoxybenzaldehyde N-tosylhydrazone |
| p-methoxybenzilidene-p-n-butylaniline |
| anisaldehyde N-tosylhydrazone |
| DL 1047 N |
| 4-Methoxybenzilidine-4'-N-butylaniline |
| Anisaldehydtosylhydrazon |