2-Fluoro-2-methyl-3-oxo-3-phenyl-propionic acid ethyl ester
Modify Date: 2025-09-15 19:14:24
2-Fluoro-2-methyl-3-oxo-3-phenyl-propionic acid ethyl ester structure
|
Common Name | 2-Fluoro-2-methyl-3-oxo-3-phenyl-propionic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 193482-31-4 | Molecular Weight | 224.22800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13FO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl 2-fluoro-2-methyl-3-oxo-3-phenylpropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13FO3 |
|---|---|
| Molecular Weight | 224.22800 |
| Exact Mass | 224.08500 |
| PSA | 43.37000 |
| LogP | 2.16060 |
| InChIKey | OFSFPYILRKIMON-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C)(F)C(=O)c1ccccc1 |
| HS Code | 2918300090 |
|---|
| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-fluoro-2-methyl-3-oxo-3-phenylpropanoic acid ethyl ester |
| 2-fluoro-2-methyl-3-oxo-3-phenylpropionic acid ethyl ester |
| Ethyl2-Methyl-2-fluoro-3-oxo-3-phenylpropanoate |
| Ethyl a-fluoro-a-methylbenzoylacetate |
| Benzenepropanoic acid,a-fluoro-a-methyl-b-oxo-,ethyl ester |
| ethyl (2R)-2-fluoro-2-methyl-3-oxo-3-phenylpropanoate |