1-(3,4-dichlorophenyl)-3-phenyl-thiourea
Modify Date: 2025-09-01 10:15:12
1-(3,4-dichlorophenyl)-3-phenyl-thiourea structure
|
Common Name | 1-(3,4-dichlorophenyl)-3-phenyl-thiourea | ||
|---|---|---|---|---|
| CAS Number | 1932-37-2 | Molecular Weight | 297.20300 | |
| Density | 1.474g/cm3 | Boiling Point | 400.6ºC at 760 mmHg | |
| Molecular Formula | C13H10Cl2N2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.1ºC | |
| Name | 1-(3,4-dichlorophenyl)-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.474g/cm3 |
|---|---|
| Boiling Point | 400.6ºC at 760 mmHg |
| Molecular Formula | C13H10Cl2N2S |
| Molecular Weight | 297.20300 |
| Flash Point | 196.1ºC |
| Exact Mass | 295.99400 |
| PSA | 56.15000 |
| LogP | 4.94830 |
| Vapour Pressure | 1.26E-06mmHg at 25°C |
| Index of Refraction | 1.749 |
| InChIKey | QJAYUNBHNKSXFD-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccccc1)Nc1ccc(Cl)c(Cl)c1 |
| HS Code | 2930909090 |
|---|
|
~79%
1-(3,4-dichloro... CAS#:1932-37-2 |
| Literature: Kubota; Horie; Misra; Toyooka; Uda; Shibuya; Terada Chemical and Pharmaceutical Bulletin, 1985 , vol. 33, # 2 p. 662 - 666 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(3,4-dichloro-phenyl)-N'-phenyl-thiourea |
| N-(3,4-Dichlor-phenyl)-N'-phenyl-thioharnstoff |