1-hydroxyxanthine
Modify Date: 2024-04-03 15:00:35
1-hydroxyxanthine structure
|
Common Name | 1-hydroxyxanthine | ||
|---|---|---|---|---|
| CAS Number | 1932-15-6 | Molecular Weight | 168.11000 | |
| Density | N/A | Boiling Point | 823.1ºC at 760mmHg | |
| Molecular Formula | C5H4N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 451.6ºC | |
| Name | 1-hydroxy-3,7-dihydropurine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 823.1ºC at 760mmHg |
|---|---|
| Molecular Formula | C5H4N4O3 |
| Molecular Weight | 168.11000 |
| Flash Point | 451.6ºC |
| Exact Mass | 168.02800 |
| PSA | 104.03000 |
| Index of Refraction | 1.765 |
| InChIKey | PJKPEFPGGBAAJE-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c2nc[nH]c2c(=O)n1O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Hydroxyxanthin |
| 1-hydroxy-3,7(9)-dihydro-purine-2,6-dione |
| 1-hydroxy-3,7-dihydro-1h-purine-2,6-dione |
| 1-Hydroxyxanthine |