methyl 3-bromo-1-methyl-1H-indazole-6-carboxylate structure
|
Common Name | methyl 3-bromo-1-methyl-1H-indazole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 192945-57-6 | Molecular Weight | 269.09500 | |
| Density | 1.61g/cm3 | Boiling Point | 366.7ºC at 760 mmHg | |
| Molecular Formula | C10H9BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.6ºC | |
| Name | methyl 3-bromo-1-methylindazole-6-carboxylate |
|---|
| Density | 1.61g/cm3 |
|---|---|
| Boiling Point | 366.7ºC at 760 mmHg |
| Molecular Formula | C10H9BrN2O2 |
| Molecular Weight | 269.09500 |
| Flash Point | 175.6ºC |
| Exact Mass | 267.98500 |
| PSA | 44.12000 |
| LogP | 2.12240 |
| Vapour Pressure | 1.44E-05mmHg at 25°C |
| Index of Refraction | 1.638 |
| InChIKey | UNQOAPFVWPFNKR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(Br)nn(C)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |