3-hydroxy-2-(4-methylphenyl)chromen-4-one structure
|
Common Name | 3-hydroxy-2-(4-methylphenyl)chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 19275-68-4 | Molecular Weight | 252.26500 | |
| Density | 1.324g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C16H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.2ºC | |
| Name | 3-hydroxy-2-(4-methylphenyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.324g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C16H12O3 |
| Molecular Weight | 252.26500 |
| Flash Point | 153.2ºC |
| Exact Mass | 252.07900 |
| PSA | 50.44000 |
| LogP | 3.47400 |
| Vapour Pressure | 2.52E-07mmHg at 25°C |
| Index of Refraction | 1.663 |
| InChIKey | QAHZLNKOVIYDGB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2oc3ccccc3c(=O)c2O)cc1 |
| HS Code | 2914400090 |
|---|
| Precursor 8 | |
|---|---|
| DownStream 1 | |
| HS Code | 2914400090 |
|---|---|
| Summary | 2914400090 other ketone-alcohols and ketone-aldehydes。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| 3-Hydroxy-2-p-tolyl-chromen-4-one |
| 3-Hydroxy-4'-methylflavone |
| 4'-Methylflavonol |