(2R)-2-[acetyl(butan-2-yl)amino]-3-sulfanylpropanoic acid
Modify Date: 2025-09-27 19:43:28
![(2R)-2-[acetyl(butan-2-yl)amino]-3-sulfanylpropanoic acid Structure](https://image.chemsrc.com/caspic/316/19216-62-7.png)
(2R)-2-[acetyl(butan-2-yl)amino]-3-sulfanylpropanoic acid structure
|
Common Name | (2R)-2-[acetyl(butan-2-yl)amino]-3-sulfanylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 19216-62-7 | Molecular Weight | 219.30100 | |
| Density | 1.148g/cm3 | Boiling Point | 357.7ºC at 760mmHg | |
| Molecular Formula | C9H17NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170.1ºC | |
| Name | (2R)-2-[acetyl(butan-2-yl)amino]-3-sulfanylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.148g/cm3 |
|---|---|
| Boiling Point | 357.7ºC at 760mmHg |
| Molecular Formula | C9H17NO3S |
| Molecular Weight | 219.30100 |
| Flash Point | 170.1ºC |
| Exact Mass | 219.09300 |
| PSA | 96.41000 |
| LogP | 1.01640 |
| Vapour Pressure | 4.4E-06mmHg at 25°C |
| Index of Refraction | 1.507 |
| InChIKey | BAYNUVSAZAGYHI-XDKWHASVSA-N |
| SMILES | CCC(C)N(C(C)=O)C(CS)C(=O)O |
|
~%
(2R)-2-[acetyl(... CAS#:19216-62-7 |
| Literature: Perrey, David A.; Scannell, Michael P.; Narla, Rama Krishna; Uckun, Fatih M. Bioorganic and Medicinal Chemistry Letters, 2000 , vol. 10, # 6 p. 551 - 552 |
|
~%
(2R)-2-[acetyl(... CAS#:19216-62-7 |
| Literature: Bray et al. Biochemical Journal, 1959 , vol. 73, p. 465,466 |
| S-n-Butyl-N-acetyl-L-cysteine |
| N-acetyl-S-butyl-L-cysteine |
| N-Acetyl-S-butyl-L-cystein |