[(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N,N-diethylcarbamodithioate structure
|
Common Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N,N-diethylcarbamodithioate | ||
|---|---|---|---|---|
| CAS Number | 19200-30-7 | Molecular Weight | 311.41800 | |
| Density | 1.43g/cm3 | Boiling Point | 503.8ºC at 760 mmHg | |
| Molecular Formula | C11H21NO5S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.5ºC | |
| Name | [(2S,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] N,N-diethylcarbamodithioate |
|---|
| Density | 1.43g/cm3 |
|---|---|
| Boiling Point | 503.8ºC at 760 mmHg |
| Molecular Formula | C11H21NO5S2 |
| Molecular Weight | 311.41800 |
| Flash Point | 258.5ºC |
| Exact Mass | 311.08600 |
| PSA | 150.78000 |
| Vapour Pressure | 2.93E-12mmHg at 25°C |
| Index of Refraction | 1.636 |
| InChIKey | NZZCKKHDYOKHCF-SPFKKGSWSA-N |
| SMILES | CCN(CC)C(=S)SC1OC(CO)C(O)C(O)C1O |
|
~%
[(2S,3R,4S,5S,6... CAS#:19200-30-7 |
| Literature: Lee; Bertram; Schmezer; Frank; Wiessler Journal of Medicinal Chemistry, 1994 , vol. 37, # 19 p. 3154 - 3162 |