Acetic acid,2-(2,4-dichlorophenoxy)-, heptyl ester structure
|
Common Name | Acetic acid,2-(2,4-dichlorophenoxy)-, heptyl ester | ||
|---|---|---|---|---|
| CAS Number | 1917-96-0 | Molecular Weight | 319.22400 | |
| Density | 1.169g/cm3 | Boiling Point | 387.7ºC at 760mmHg | |
| Molecular Formula | C15H20Cl2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 138ºC | |
| Name | 2,4-Dichlorphenoxyessigsaeure-heptylester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.169g/cm3 |
|---|---|
| Boiling Point | 387.7ºC at 760mmHg |
| Molecular Formula | C15H20Cl2O3 |
| Molecular Weight | 319.22400 |
| Flash Point | 138ºC |
| Exact Mass | 318.07900 |
| PSA | 35.53000 |
| LogP | 4.88580 |
| Vapour Pressure | 3.24E-06mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | HZQJGWTYZAWPLJ-UHFFFAOYSA-N |
| SMILES | CCCCCCCOC(=O)COc1ccc(Cl)cc1Cl |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2,4-Dichlor-phenoxy-essigsaeure-<2-nitro-anilid> |
| heptyl 2,4-dichlorophenoxyacetate |