9H-Fluoren-9-one,4-chloro-7-fluoro-2-nitro-
Modify Date: 2025-09-15 10:27:03
9H-Fluoren-9-one,4-chloro-7-fluoro-2-nitro- structure
|
Common Name | 9H-Fluoren-9-one,4-chloro-7-fluoro-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 1914-40-5 | Molecular Weight | 277.63500 | |
| Density | 1.606g/cm3 | Boiling Point | 459.9ºC at 760 mmHg | |
| Molecular Formula | C13H5ClFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 231.9ºC | |
| Name | 4-chloro-7-fluoro-2-nitrofluoren-9-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.606g/cm3 |
|---|---|
| Boiling Point | 459.9ºC at 760 mmHg |
| Molecular Formula | C13H5ClFNO3 |
| Molecular Weight | 277.63500 |
| Flash Point | 231.9ºC |
| Exact Mass | 276.99400 |
| PSA | 62.89000 |
| LogP | 4.12190 |
| Vapour Pressure | 1.22E-08mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | JHXAAYIRHSMPGH-UHFFFAOYSA-N |
| SMILES | O=C1c2cc(F)ccc2-c2c(Cl)cc([N+](=O)[O-])cc21 |
|
~%
9H-Fluoren-9-on... CAS#:1914-40-5 |
| Literature: Pan; Fletcher Journal of medicinal chemistry, 1965 , vol. 8, # 4 p. 491 - 497 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-chloro-7-fluoro-2-nitro-9h-fluoren-9-one |
| 4-Chlor-7-fluor-2-nitro-9-oxo-fluoren |