methyl 2-[(4-methylphenyl)sulfonylamino]pent-4-ynoate structure
|
Common Name | methyl 2-[(4-methylphenyl)sulfonylamino]pent-4-ynoate | ||
|---|---|---|---|---|
| CAS Number | 191215-76-6 | Molecular Weight | 281.32800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[(4-methylphenyl)sulfonylamino]pent-4-ynoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15NO4S |
|---|---|
| Molecular Weight | 281.32800 |
| Exact Mass | 281.07200 |
| PSA | 80.85000 |
| LogP | 2.30990 |
| InChIKey | APKXEPNOMLHZAN-UHFFFAOYSA-N |
| SMILES | C#CCC(NS(=O)(=O)c1ccc(C)cc1)C(=O)OC |
|
~69%
methyl 2-[(4-me... CAS#:191215-76-6 |
| Literature: Knight, David W.; Redfern, Adele L.; Gilmore, Jeremy Journal of the Chemical Society. Perkin Transactions 1, 2002 , # 5 p. 622 - 628 |
|
~%
methyl 2-[(4-me... CAS#:191215-76-6 |
| Literature: SANOFI-AVENTIS Patent: US2009/281116 A1, 2009 ; Location in patent: Page/Page column 9-10 ; |
|
~%
methyl 2-[(4-me... CAS#:191215-76-6 |
| Literature: Knight, David W.; Redfern, Adele L.; Gilmore, Jeremy Chemical Communications, 1998 , # 20 p. 2207 - 2208 |
| 4-Pentynoic acid,2-[[(4-methylphenyl)sulfonyl]amino]-,methyl ester |
| 2-(toluene-4-sulfonylamino)-pent-4-ynoic acid methyl ester |
| methyl 2-(4-tolylsulfonylamino)pent-4-ynoate |
| methyl 2-(((4-methylphenyl)sulfonyl)amino)pent-3-ynoate |
| methyl 2-(((4-methylphenyl)sulfonyl)amino)pent-4-ynoate |