sodium 2-(4-chloro-2-methylphenoxy)propionate
Modify Date: 2025-09-01 22:03:57
sodium 2-(4-chloro-2-methylphenoxy)propionate structure
|
Common Name | sodium 2-(4-chloro-2-methylphenoxy)propionate | ||
|---|---|---|---|---|
| CAS Number | 19095-88-6 | Molecular Weight | 236.62700 | |
| Density | 1.265g/cm3 | Boiling Point | 331.9ºC at 760mmHg | |
| Molecular Formula | C10H10ClNaO3 | Melting Point | 94-95ºC | |
| MSDS | N/A | Flash Point | 154.5ºC | |
| Name | mecoprop-sodium |
|---|---|
| Synonym | More Synonyms |
| Density | 1.265g/cm3 |
|---|---|
| Boiling Point | 331.9ºC at 760mmHg |
| Melting Point | 94-95ºC |
| Molecular Formula | C10H10ClNaO3 |
| Molecular Weight | 236.62700 |
| Flash Point | 154.5ºC |
| Exact Mass | 236.02200 |
| PSA | 49.36000 |
| LogP | 1.16560 |
| Vapour Pressure | 6.04E-05mmHg at 25°C |
| InChIKey | DHJHUXNTNSRSEX-UHFFFAOYSA-M |
| SMILES | Cc1cc(Cl)ccc1OC(C)C(=O)[O-].[Na+] |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| sodium 2-(4-chloro-2-methylphenoxy)propanoate |
| Mecoprop-sodium |
| sodium (RS)-2-(4-chloro-o-tolyloxy)propionate |
| 93-65-2 (Parent) |
| rac-sodium (2R)-2-(4-chloro-2-methylphenoxy)propanoate |
| EINECS 242-815-6 |
| Mecoprop sodium salt |
| Propionic acid,2-((4-chloro-o-tolyl)oxy)-,sodium salt |
| Mecoprop-sodium [ISO] |
| Sodium D-2-methyl-4-chlorophenoxypropionate |
| UNII-YE9E66W3DN |
| sodium (+/-)-2-(4-chloro-2-methylphenoxy)propionate |
| 2-(2-Methyl-4-chlorophenoxy)propionic acid,sodium salt |
| sodium,2-(4-chloro-2-methylphenoxy)propanoate |