ethyl (3,4-dichlorophenyl)carbamothioylsulfanylformate structure
|
Common Name | ethyl (3,4-dichlorophenyl)carbamothioylsulfanylformate | ||
|---|---|---|---|---|
| CAS Number | 19079-19-7 | Molecular Weight | 310.22000 | |
| Density | 1.515g/cm3 | Boiling Point | 392.8ºC at 760 mmHg | |
| Molecular Formula | C10H9Cl2NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 191.3ºC | |
| Name | ethyl (3,4-dichlorophenyl)carbamothioylsulfanylformate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.515g/cm3 |
|---|---|
| Boiling Point | 392.8ºC at 760 mmHg |
| Molecular Formula | C10H9Cl2NO2S2 |
| Molecular Weight | 310.22000 |
| Flash Point | 191.3ºC |
| Exact Mass | 308.94500 |
| PSA | 102.76000 |
| LogP | 4.80040 |
| Vapour Pressure | 2.24E-06mmHg at 25°C |
| Index of Refraction | 1.671 |
| InChIKey | FQRLCAKTNMCZOE-UHFFFAOYSA-N |
| SMILES | CCOC(=O)SC(=S)Nc1ccc(Cl)c(Cl)c1 |
| Carbonic acid,thio-,anhydrosulfide with 3,4-dichlorodithiocarbanilic acid,ethyl ester |
| Thiocarbonic acid anhydrosulfide with 3,4-dichlorodithiocarbanilic acid ethyl ester |