Bepotastine Besilate structure
|
Common Name | Bepotastine Besilate | ||
|---|---|---|---|---|
| CAS Number | 190786-44-8 | Molecular Weight | 547.063 | |
| Density | N/A | Boiling Point | 546.8ºC at 760 mmHg | |
| Molecular Formula | C27H31ClN2O6S | Melting Point | 161-163° | |
| MSDS | N/A | Flash Point | 284.5ºC | |
Use of Bepotastine BesilateBepotastine Beslilate (Bepreve) is a histamine H1 receptor anatagonist. IC50 value:Target: Histamine H1 receptorBepotastine Beslilate (Bepreve) also suppresses some allergic inflammatory processes such as allergic rhinitis, chronic urticaria or pruritus associated with skin conditions (eczema/dermatitis, prurigo or pruritus cutaneus).Bepotastine Beslilate (Bepreve) is useful for allergic conjunctivitis. |
| Name | bepotastine besylate |
|---|---|
| Synonym | More Synonyms |
| Description | Bepotastine Beslilate (Bepreve) is a histamine H1 receptor anatagonist. IC50 value:Target: Histamine H1 receptorBepotastine Beslilate (Bepreve) also suppresses some allergic inflammatory processes such as allergic rhinitis, chronic urticaria or pruritus associated with skin conditions (eczema/dermatitis, prurigo or pruritus cutaneus).Bepotastine Beslilate (Bepreve) is useful for allergic conjunctivitis. |
|---|---|
| Related Catalog | |
| References |
| Boiling Point | 546.8ºC at 760 mmHg |
|---|---|
| Melting Point | 161-163° |
| Molecular Formula | C27H31ClN2O6S |
| Molecular Weight | 547.063 |
| Flash Point | 284.5ºC |
| Exact Mass | 546.159119 |
| PSA | 125.41000 |
| LogP | 6.12220 |
| Vapour Pressure | 8.63E-13mmHg at 25°C |
| InChIKey | UDGHXQPQKQPSBB-BOXHHOBZSA-N |
| SMILES | O=C(O)CCCN1CCC(OC(c2ccc(Cl)cc2)c2ccccn2)CC1.O=S(=O)(O)c1ccccc1 |
| Hazard Codes | Xi |
|---|
| Bepotastine benzenesulfonate salt |
| UNII:6W18MO1QR3 |
| Bepotastine Besilate |
| benzenesulfonic acid,4-[4-[(S)-(4-chlorophenyl)-pyridin-2-ylmethoxy]piperidin-1-yl]butanoic acid |
| 4-{4-[(S)-(4-chlorophenyl)(pyridin-2-yl)methoxy]piperidin-1-yl}butanoic acid benzenesulfonate |
| 4-{4-[(S)-(4-Chlorophenyl)(2-pyridinyl)methoxy]-1-piperidinyl}butanoic acid benzenesulfonate (1:1) |
| Talion |
| Bepotastine besylate |
| UNII-6W18MO1QR3 |
| TAU-284 |
| Bepotastine benzenesulfonate |
| Betotastine besilate |
| 1-Piperidinebutanoic acid, 4-[(S)-(4-chlorophenyl)-2-pyridinylmethoxy]-, benzenesulfonate (1:1) |
| Bepotastine (Beslilate) |
| Bepreve |
| 4-{4-[(S)-(4-Chlorophenyl)(pyridin-2-yl)methoxy]piperidin-1-yl}butanoic acid benzenesulfonate (1:1) |