7-Bromo-5-chloro-1-benzofuran-2-carboxylicacid
Modify Date: 2025-09-18 13:29:53
7-Bromo-5-chloro-1-benzofuran-2-carboxylicacid structure
|
Common Name | 7-Bromo-5-chloro-1-benzofuran-2-carboxylicacid | ||
|---|---|---|---|---|
| CAS Number | 190775-65-6 | Molecular Weight | 275.48300 | |
| Density | 1.873g/cm3 | Boiling Point | 399.4ºC at 760 mmHg | |
| Molecular Formula | C9H4BrClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.4ºC | |
| Name | 7-bromo-5-chloro-1-benzofuran-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.873g/cm3 |
|---|---|
| Boiling Point | 399.4ºC at 760 mmHg |
| Molecular Formula | C9H4BrClO3 |
| Molecular Weight | 275.48300 |
| Flash Point | 195.4ºC |
| Exact Mass | 273.90300 |
| PSA | 50.44000 |
| LogP | 3.54690 |
| Vapour Pressure | 4.26E-07mmHg at 25°C |
| Index of Refraction | 1.685 |
| InChIKey | MDSRFGXNBDNKHI-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc2cc(Cl)cc(Br)c2o1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD04208738 |