Benzamide, N-(alpha-(chloromethyl)phenethyl)-
Modify Date: 2025-11-25 15:16:57
Benzamide, N-(alpha-(chloromethyl)phenethyl)- structure
|
Common Name | Benzamide, N-(alpha-(chloromethyl)phenethyl)- | ||
|---|---|---|---|---|
| CAS Number | 19071-62-6 | Molecular Weight | 273.75700 | |
| Density | 1.163g/cm3 | Boiling Point | 482.2ºC at 760mmHg | |
| Molecular Formula | C16H16ClNO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 245.4ºC | |
| Name | N-(1-Chloro-3-phenyl-2-propanyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.163g/cm3 |
|---|---|
| Boiling Point | 482.2ºC at 760mmHg |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.75700 |
| Flash Point | 245.4ºC |
| Exact Mass | 273.09200 |
| PSA | 32.59000 |
| LogP | 3.84130 |
| Vapour Pressure | 1.87E-09mmHg at 25°C |
| Index of Refraction | 1.581 |
| InChIKey | PPDXKKJMVOBAND-UHFFFAOYSA-N |
| SMILES | O=C(NC(CCl)Cc1ccccc1)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2SR)-aminosuberic acid |
| dl-2-Benzamido-1-chlor-3-phenyl-propan |
| DL-2-aminosuberic acid |
| 3-phenyl-2-benzamido-1-chloropropane |
| 2-aminosuberic acid |
| 2-amino-octanedioic acid |