Adamantane-2-ol acetate structure
|
Common Name | Adamantane-2-ol acetate | ||
|---|---|---|---|---|
| CAS Number | 19066-22-9 | Molecular Weight | 211.27700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H19O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | adamantan-2-ol,acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H19O3 |
|---|---|
| Molecular Weight | 211.27700 |
| Exact Mass | 211.13300 |
| PSA | 60.36000 |
| LogP | 0.55960 |
| InChIKey | KCRIKUHGRAGLSF-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1C2CC3CC(C2)CC1C3 |
| HS Code | 2915390090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915390090 |
|---|---|
| Summary | 2915390090. esters of acetic acid. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:5.5%. General tariff:30.0% |
| Adamantane-2-ol acetate |