2-[[N-(p-Carboxyphenyl)glycyl]amino]acetonitrile structure
|
Common Name | 2-[[N-(p-Carboxyphenyl)glycyl]amino]acetonitrile | ||
|---|---|---|---|---|
| CAS Number | 19065-92-0 | Molecular Weight | 233.22300 | |
| Density | 1.369g/cm3 | Boiling Point | 614.2ºC at 760 mmHg | |
| Molecular Formula | C11H11N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 325.2ºC | |
| Name | 4-[[2-(cyanomethylamino)-2-oxoethyl]amino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.369g/cm3 |
|---|---|
| Boiling Point | 614.2ºC at 760 mmHg |
| Molecular Formula | C11H11N3O3 |
| Molecular Weight | 233.22300 |
| Flash Point | 325.2ºC |
| Exact Mass | 233.08000 |
| PSA | 105.71000 |
| LogP | 1.34978 |
| Vapour Pressure | 6.11E-16mmHg at 25°C |
| Index of Refraction | 1.625 |
| InChIKey | ILTWRLHXJMWZHP-UHFFFAOYSA-N |
| SMILES | N#CCNC(=O)CNc1ccc(C(=O)O)cc1 |
| HS Code | 2926909090 |
|---|
|
~%
2-[[N-(p-Carbox... CAS#:19065-92-0 |
| Literature: Suzue; Irikura Chemical and pharmaceutical bulletin, 1968 , vol. 16, # 8 p. 1417 - 1432 |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-Carboxyphenylglycylaminoacetonitrile |
| N-<N-(p-Carboxyphenyl)glycyl>aminoacetonitril |
| Carboxyphenyl glycyl aminoacetonitrile |
| 4-({2-[(cyanomethyl)amino]-2-oxoethyl}amino)benzoic acid |
| p-Carboxyphenylglycylaminoacetonitrile |