2-Boc-amino-4-bromomethylpyridine structure
|
Common Name | 2-Boc-amino-4-bromomethylpyridine | ||
|---|---|---|---|---|
| CAS Number | 190189-98-1 | Molecular Weight | 287.15300 | |
| Density | 1.427g/cm3 | Boiling Point | 330.9ºC at 760mmHg | |
| Molecular Formula | C11H15BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.9ºC | |
| Name | tert-butyl 3-amino-4-(bromomethyl)pyridine-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 330.9ºC at 760mmHg |
| Molecular Formula | C11H15BrN2O2 |
| Molecular Weight | 287.15300 |
| Flash Point | 153.9ºC |
| Exact Mass | 286.03200 |
| PSA | 54.71000 |
| LogP | 3.33710 |
| Vapour Pressure | 0.000162mmHg at 25°C |
| Index of Refraction | 1.579 |
| InChIKey | TWFAMEOZPYPOIV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)Nc1cc(CBr)ccn1 |
|
~82%
2-Boc-amino-4-b... CAS#:190189-98-1 |
| Literature: Polla, Magnus O.; Tottie, Louise; Norden, Carita; Linschoten, Marcel; Muesil, Djordje; Trumpp-Kallmeyer, Susanne; Aukrust, Inger R.; Ringom, Rune; Holm, Kjetil H.; Neset, Siren M.; Sandberg, Marcel; Thurmond, John; Yu, Peng; Hategan, Georgeta; Anderson, Herb Bioorganic and Medicinal Chemistry, 2004 , vol. 12, # 5 p. 1151 - 1175 |
|
~%
2-Boc-amino-4-b... CAS#:190189-98-1 |
| Literature: Merck and Co., Inc. Patent: US5852045 A1, 1998 ; |
|
~%
2-Boc-amino-4-b... CAS#:190189-98-1 |
| Literature: Polla, Magnus O.; Tottie, Louise; Norden, Carita; Linschoten, Marcel; Muesil, Djordje; Trumpp-Kallmeyer, Susanne; Aukrust, Inger R.; Ringom, Rune; Holm, Kjetil H.; Neset, Siren M.; Sandberg, Marcel; Thurmond, John; Yu, Peng; Hategan, Georgeta; Anderson, Herb Bioorganic and Medicinal Chemistry, 2004 , vol. 12, # 5 p. 1151 - 1175 |
| 4-bromomethyl-2-tert-butoxycarbonylaminopyridine |
| 2-N-Boc-Amino-4-bromomethyl pyridine |
| 2-Boc-amino-4-bromomethylpyridine |