1-[2-(ethylpropylamino)ethyl]-1,1-dimethylhydrazinium chloride structure
|
Common Name | 1-[2-(ethylpropylamino)ethyl]-1,1-dimethylhydrazinium chloride | ||
|---|---|---|---|---|
| CAS Number | 19014-41-6 | Molecular Weight | 209.76000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H24ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | amino-[2-[ethyl(propyl)amino]ethyl]-dimethylazanium,chloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H24ClN3 |
|---|---|
| Molecular Weight | 209.76000 |
| Exact Mass | 209.16600 |
| PSA | 29.26000 |
| InChIKey | WFFPWUJDOLBPSL-UHFFFAOYSA-M |
| SMILES | CCCN(CC)CC[N+](C)(C)N.[Cl-] |
| HS Code | 2928000090 |
|---|
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| Hydrazinium,1-[2-(ethylphenylamino)ethyl]-1,1-dimethyl-,chloride (1:1) |
| N,N-Dimethyl-N-(N-ethyl-N-phenylaminoethyl)hydraziniumchlorid |
| Hydrazinium,1-[2-(ethylphenylamino)ethyl]-1,1-dimethyl-,chloride (8CI,9CI) |
| 1-[2-(ethylpropylamino)ethyl]-1,1-dimethylhydrazinium chloride |