Benzyl p-aminobenzoate structure
|
Common Name | Benzyl p-aminobenzoate | ||
|---|---|---|---|---|
| CAS Number | 19008-43-6 | Molecular Weight | 227.25900 | |
| Density | 1.194g/cm3 | Boiling Point | 411.8ºC at 760 mmHg | |
| Molecular Formula | C14H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 242.1ºC | |
| Name | benzyl 4-aminobenzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.194g/cm3 |
|---|---|
| Boiling Point | 411.8ºC at 760 mmHg |
| Molecular Formula | C14H13NO2 |
| Molecular Weight | 227.25900 |
| Flash Point | 242.1ºC |
| Exact Mass | 227.09500 |
| PSA | 52.32000 |
| LogP | 3.20700 |
| Vapour Pressure | 5.42E-07mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | DAOPOOMCXJPWPK-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)OCc2ccccc2)cc1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| phenylmethyl 4-aminobenzoate |
| Benzyl p-aminobenzoate |
| p-aminobenzoic acid benzyl ester |
| 4-Amino-benzoesaeure-benzylester |
| 4-Aminobenzoic acid benzyl ester |
| benzyl para-aminobenzoate |