3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid
Modify Date: 2026-07-31 11:01:08
3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid structure
|
Common Name | 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 1897357-53-7 | Molecular Weight | 287.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15BrO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H15BrO3 |
|---|---|
| Molecular Weight | 287.15 |
| InChIKey | XFXRKBCNEZDQCU-UHFFFAOYSA-N |
| SMILES | COc1cccc(Br)c1CC(C)(C)C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid? |
| A: SMILES notation of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid is COc1cccc(Br)c1CC(C)(C)C(=O)O. |
| Q: What is the CAS number of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid? |
| A: CAS number of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid is 1897357-53-7. |
| Q: What is the molecular formula of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid? |
| A: Molecular formula of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid is C12H15BrO3. |
| Q: What is the Chinese name of 1897357-53-7? |
| A: Chinese name of 1897357-53-7 is 1897357-53-7. |
| Q: What is the English name of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid? |
| A: The English name of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid is 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid. |
| Q: What is the InChIKey of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid? |
| A: InChIKey of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid is XFXRKBCNEZDQCU-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid? |
| A: Molecular weight of 3-(2-Bromo-6-methoxyphenyl)-2,2-dimethylpropanoic acid is 287.15. |