2,6-dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ol
Modify Date: 2025-10-09 13:18:57
2,6-dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ol structure
|
Common Name | 2,6-dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ol | ||
|---|---|---|---|---|
| CAS Number | 18964-65-3 | Molecular Weight | 296.40600 | |
| Density | 1.59g/cm3 | Boiling Point | 370.3ºC at 760 mmHg | |
| Molecular Formula | C8H7Cl5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 177.7ºC | |
| Name | 2,6-dichloro-4-methyl-4-(trichloromethyl)cyclohexa-2,5-dien-1-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.59g/cm3 |
|---|---|
| Boiling Point | 370.3ºC at 760 mmHg |
| Molecular Formula | C8H7Cl5O |
| Molecular Weight | 296.40600 |
| Flash Point | 177.7ºC |
| Exact Mass | 293.89400 |
| PSA | 20.23000 |
| LogP | 3.98280 |
| Vapour Pressure | 5.44E-07mmHg at 25°C |
| Index of Refraction | 1.584 |
| InChIKey | NZNQIHCRWPUSAI-UHFFFAOYSA-N |
| SMILES | CC1(C(Cl)(Cl)Cl)C=C(Cl)C(O)C(Cl)=C1 |
|
~%
2,6-dichloro-4-... CAS#:18964-65-3 |
| Literature: Yagupol'skii,L.M.; Matyushecheva,G.I. Journal of Organic Chemistry USSR (English Translation), 1968 , vol. 4, p. 824 - 827 Zhurnal Organicheskoi Khimii, 1968 , vol. 4, # 5 p. 848 - 851 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1-Methyl-1-trichlormethyl-3,5-dichlor-cyclohexadien-(2,5)-ol-(4) |
| 2,6-dichloro-4-methyl-4-trichloromethyl-cyclohexa-2,5-dienol |
| 2,6-Dichlor-4-methyl-4-trichlormethyl-cyclohexa-2,5-dienol |