9-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-3H-purin-6-one
Modify Date: 2025-11-29 17:33:44
![9-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-3H-purin-6-one Structure](https://image.chemsrc.com/caspic/095/18945-36-3.png)
9-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-3H-purin-6-one structure
|
Common Name | 9-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-3H-purin-6-one | ||
|---|---|---|---|---|
| CAS Number | 18945-36-3 | Molecular Weight | 378.12300 | |
| Density | 2.53g/cm3 | Boiling Point | 719.1ºC at 760 mmHg | |
| Molecular Formula | C10H11IN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.7ºC | |
| Name | 9-[3,4-dihydroxy-5-(iodomethyl)oxolan-2-yl]-3H-purin-6-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.53g/cm3 |
|---|---|
| Boiling Point | 719.1ºC at 760 mmHg |
| Molecular Formula | C10H11IN4O4 |
| Molecular Weight | 378.12300 |
| Flash Point | 388.7ºC |
| Exact Mass | 377.98300 |
| PSA | 113.26000 |
| Vapour Pressure | 1.05E-21mmHg at 25°C |
| Index of Refraction | 1.925 |
| InChIKey | NUNPMJRQMLQDQC-KQYNXXCUSA-N |
| SMILES | O=c1[nH]cnc2c1ncn2C1OC(CI)C(O)C1O |
|
~71%
9-[3,4-dihydrox... CAS#:18945-36-3 |
| Literature: McGuigan, Christopher; Daverio, Felice; Najera, Isabel; Martin, Joseph A.; Klumpp, Klaus; Smith, David B. Bioorganic and Medicinal Chemistry Letters, 2009 , vol. 19, # 11 p. 3122 - 3124 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5'-iodo-5'-deoxy-inosine |
| 5'-Deoxy-5'-jodoinosin |
| 5'-Iod-5'-desoxy-inosin |
| 9-(5-deoxy-5-iodopentofuranosyl)-3,9-dihydro-6h-purin-6-one |
| 5'-Deoxy-5'-iodadenosin |
| 5'-deoxy-5'-iodoinosine |