3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-one
Modify Date: 2025-08-26 20:30:31
![3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-one Structure](https://image.chemsrc.com/caspic/433/189102-39-4.png)
3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-one structure
|
Common Name | 3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-one | ||
|---|---|---|---|---|
| CAS Number | 189102-39-4 | Molecular Weight | 216.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H24O2Si | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[tert-butyl(dimethyl)silyl]oxy-3-methylbutan-2-one |
|---|
| Molecular Formula | C11H24O2Si |
|---|---|
| Molecular Weight | 216.39300 |
| Exact Mass | 216.15500 |
| PSA | 26.30000 |
| LogP | 3.37580 |
| InChIKey | HQKCSFKORVBLEZ-UHFFFAOYSA-N |
| SMILES | CC(=O)C(C)(C)O[Si](C)(C)C(C)(C)C |
|
~70%
3-[tert-butyl(d... CAS#:189102-39-4 |
| Literature: Li, Weidong; Qu, Jin; Li, Jing; Li, Ying; Li, Yulin Journal of the Chinese Chemical Society, 1997 , vol. 44, # 5 p. 507 - 510 |
