AMB
Modify Date: 2025-08-24 23:28:30
AMB structure
|
Common Name | AMB | ||
|---|---|---|---|---|
| CAS Number | 1890250-13-1 | Molecular Weight | 345.436 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 531.3±30.0 °C at 760 mmHg | |
| Molecular Formula | C19H27N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 275.1±24.6 °C | |
Use of AMBAMB is an analog of AB-PINACA, intended for research and forensic applications. |
| Name | AMB |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 531.3±30.0 °C at 760 mmHg |
| Molecular Formula | C19H27N3O3 |
| Molecular Weight | 345.436 |
| Flash Point | 275.1±24.6 °C |
| Exact Mass | 345.205231 |
| LogP | 3.68 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.565 |
| InChIKey | KTTMFFHXDMTTOB-INIZCTEOSA-N |
| SMILES | CCCCCn1nc(C(=O)NC(C(=O)OC)C(C)C)c2ccccc21 |
| Methyl N-[(1-pentyl-1H-indazol-3-yl)carbonyl]-L-valinate |
| L-Valine, N-[(1-pentyl-1H-indazol-3-yl)carbonyl]-, methyl ester |
| AMB |
| methyl (1-pentyl-1H-indazole-3-carbonyl)-L-valinate |