(s)-(+)-nalpha-benzyl-nbeta-boc-l-hydrazinoisoleucine structure
|
Common Name | (s)-(+)-nalpha-benzyl-nbeta-boc-l-hydrazinoisoleucine | ||
|---|---|---|---|---|
| CAS Number | 188777-47-1 | Molecular Weight | 336.42600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H28N2O4 | Melting Point | 103-109ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2S,3S)-2-[benzyl-[(2-methylpropan-2-yl)oxycarbonylamino]amino]-3-methylpentanoate |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 103-109ºC |
|---|---|
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.42600 |
| Exact Mass | 336.20500 |
| PSA | 78.87000 |
| LogP | 3.81850 |
| InChIKey | VOVAEVRERZBTPA-AWKYBWMHSA-N |
| SMILES | CCC(C)C(C(=O)O)N(Cc1ccccc1)NC(=O)OC(C)(C)C |
| Storage condition | Refrigerator (+4°C) |
| HS Code | 2928000090 |
|---|
|
~75%
(s)-(+)-nalpha-... CAS#:188777-47-1 |
| Literature: Guy, Laure; Vidal, Joelle; Collet, Andre; Amour, Augustin; Reboud-Ravaux, Michele Journal of Medicinal Chemistry, 1998 , vol. 41, # 24 p. 4833 - 4843 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2928000090 |
|---|---|
| Summary | 2928000090 other organic derivatives of hydrazine or of hydroxylamine VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| (S)-(+)-Nalpha-Benzyl-Nbeta-BOC-L-hydrazinoisoleucine |
| MFCD01320658 |