(R)-2-(4-(BENZYLOXY)-3-NITROPHENYL)OXIRANE structure
|
Common Name | (R)-2-(4-(BENZYLOXY)-3-NITROPHENYL)OXIRANE | ||
|---|---|---|---|---|
| CAS Number | 188730-94-1 | Molecular Weight | 271.26800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2R)-2-(3-nitro-4-phenylmethoxyphenyl)oxirane |
|---|
| Molecular Formula | C15H13NO4 |
|---|---|
| Molecular Weight | 271.26800 |
| Exact Mass | 271.08400 |
| PSA | 67.58000 |
| LogP | 3.76830 |
| InChIKey | MOGUBMMGIJLRHQ-HNNXBMFYSA-N |
| SMILES | O=[N+]([O-])c1cc(C2CO2)ccc1OCc1ccccc1 |
| HS Code | 2910900090 |
|---|
| HS Code | 2910900090 |
|---|---|
| Summary | 2910900090. epoxides, epoxyalcohols, epoxyphenols and epoxyethers, with a three-membered ring, and their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |