2-Propanone,1-([1,1'-biphenyl]-4-yloxy)- structure
|
Common Name | 2-Propanone,1-([1,1'-biphenyl]-4-yloxy)- | ||
|---|---|---|---|---|
| CAS Number | 18859-38-6 | Molecular Weight | 226.27000 | |
| Density | 1.083g/cm3 | Boiling Point | 369ºC at 760mmHg | |
| Molecular Formula | C15H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 165.9ºC | |
| Name | 1-(4-phenylphenoxy)propan-2-one |
|---|
| Density | 1.083g/cm3 |
|---|---|
| Boiling Point | 369ºC at 760mmHg |
| Molecular Formula | C15H14O2 |
| Molecular Weight | 226.27000 |
| Flash Point | 165.9ºC |
| Exact Mass | 226.09900 |
| PSA | 26.30000 |
| LogP | 3.32140 |
| Vapour Pressure | 1.22E-05mmHg at 25°C |
| Index of Refraction | 1.552 |
| InChIKey | TYMKZKHZVXYJPK-UHFFFAOYSA-N |
| SMILES | CC(=O)COc1ccc(-c2ccccc2)cc1 |
| HS Code | 2914509090 |
|---|
|
~76%
2-Propanone,1-(... CAS#:18859-38-6 |
| Literature: Qu, Zhaohui; Shi, Weifeng; Wang, Jianbo Journal of Organic Chemistry, 2004 , vol. 69, # 1 p. 217 - 219 |
|
~%
2-Propanone,1-(... CAS#:18859-38-6 |
| Literature: Baker,B.R.; Hurlbut,J.A. Journal of Medicinal Chemistry, 1967 , vol. 10, p. 1129 - 1133 |
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |