Fmoc-NH-PEG6-alcohol
Modify Date: 2025-11-09 19:47:32
Fmoc-NH-PEG6-alcohol structure
|
Common Name | Fmoc-NH-PEG6-alcohol | ||
|---|---|---|---|---|
| CAS Number | 1884208-29-0 | Molecular Weight | 503.58 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H37NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-NH-PEG6-alcoholFmoc-NH-PEG6-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Fmoc-NH-PEG6-alcohol is extracted from patent WO2016030791, example comp 91[1]. |
| Name | Fmoc-NH-PEG6-alcohol |
|---|
| Description | Fmoc-NH-PEG6-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs). Fmoc-NH-PEG6-alcohol is extracted from patent WO2016030791, example comp 91[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Fmoc-NH-PEG6-alcohol is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| References |
[1]. WO201603079 |
| Molecular Formula | C27H37NO8 |
|---|---|
| Molecular Weight | 503.58 |
| InChIKey | JQTKONDHKVRJBA-UHFFFAOYSA-N |
| SMILES | O=C(NCCOCCOCCOCCOCCOCCO)OCC1c2ccccc2-c2ccccc21 |